C25H20N4O7 — CID 126412389
2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetic acid (PubChem CID 126412389) has the molecular formula C25H20N4O7 and a molecular weight of 488.46 g/mol. Its IUPAC name is 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126412389 |
| Molecular Formula | C25H20N4O7 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCC(=O)O |
| InChI | InChI=1S/C25H20N4O7/c1-2-35-21-13-16(12-20(29(33)34)23(21)36-15-22(30)31)14-26-28-24(17-8-4-3-5-9-17)27-19-11-7-6-10-18(19)25(28)32/h3-14H,2,15H2,1H3,(H,30,31) |
| InChIKey | WKSAEYPZMGMUHG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|