C32H27N5O6 — CID 126406267
2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126406267) has the molecular formula C32H27N5O6 and a molecular weight of 577.60 g/mol. Its IUPAC name is 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126406267 |
| Molecular Formula | C32H27N5O6 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 2-[2-ethoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C32H27N5O6/c1-3-42-28-18-22(17-27(37(40)41)30(28)43-20-29(38)34-24-15-13-21(2)14-16-24)19-33-36-31(23-9-5-4-6-10-23)35-26-12-8-7-11-25(26)32(36)39/h4-19H,3,20H2,1-2H3,(H,34,38) |
| InChIKey | BYNDPOFQBSRYCM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|