C24H19N5O6 — CID 126409034
2-[2-methoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetamide (PubChem CID 126409034) has the molecular formula C24H19N5O6 and a molecular weight of 473.45 g/mol. Its IUPAC name is 2-[2-methoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetamide.
| Compound Name | 2-[2-methoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126409034 |
| Molecular Formula | C24H19N5O6 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[2-methoxy-6-nitro-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetamide |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCC(N)=O |
| InChI | InChI=1S/C24H19N5O6/c1-34-20-12-15(11-19(29(32)33)22(20)35-14-21(25)30)13-26-28-23(16-7-3-2-4-8-16)27-18-10-6-5-9-17(18)24(28)31/h2-13H,14H2,1H3,(H2,25,30) |
| InChIKey | QALLWZJNUHLOGM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|