C29H20Br2N4O5 — CID 126406598
3-[[4-[(2,4-dibromophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126406598) has the molecular formula C29H20Br2N4O5 and a molecular weight of 664.31 g/mol. Its IUPAC name is 3-[[4-[(2,4-dibromophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[4-[(2,4-dibromophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126406598 |
| Molecular Formula | C29H20Br2N4O5 |
| Molecular Weight | 664.31 g/mol |
| Exact Mass | 661.98 |
| IUPAC Name | 3-[[4-[(2,4-dibromophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C29H20Br2N4O5/c1-39-26-14-18(13-25(35(37)38)27(26)40-17-20-11-12-21(30)15-23(20)31)16-32-34-28(19-7-3-2-4-8-19)33-24-10-6-5-9-22(24)29(34)36/h2-16H,17H2,1H3 |
| InChIKey | GFOVDSMDAIILBR-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.31 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|