C28H19Br2N3O2 — CID 126409506
3-[[3-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126409506) has the molecular formula C28H19Br2N3O2 and a molecular weight of 589.29 g/mol. Its IUPAC name is 3-[[3-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[3-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126409506 |
| Molecular Formula | C28H19Br2N3O2 |
| Molecular Weight | 589.29 g/mol |
| Exact Mass | 586.98 |
| IUPAC Name | 3-[[3-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1N=Cc1cccc(OCc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C28H19Br2N3O2/c29-22-14-13-21(25(30)16-22)18-35-23-10-6-7-19(15-23)17-31-33-27(20-8-2-1-3-9-20)32-26-12-5-4-11-24(26)28(33)34/h1-17H,18H2 |
| InChIKey | SKYRNVOOTHZJHW-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.29 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|