C23H18BrN3O2 — CID 126409174
3-[(3-bromo-4-ethoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126409174) has the molecular formula C23H18BrN3O2 and a molecular weight of 448.32 g/mol. Its IUPAC name is 3-[(3-bromo-4-ethoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[(3-bromo-4-ethoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126409174 |
| Molecular Formula | C23H18BrN3O2 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 3-[(3-bromo-4-ethoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | CCOc1ccc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc1Br |
| InChI | InChI=1S/C23H18BrN3O2/c1-2-29-21-13-12-16(14-19(21)24)15-25-27-22(17-8-4-3-5-9-17)26-20-11-7-6-10-18(20)23(27)28/h3-15H,2H2,1H3 |
| InChIKey | QSWKEATWLKVHKK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|