C26H22BrN3O5 — CID 126410101
ethyl 2-[2-bromo-6-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetate (PubChem CID 126410101) has the molecular formula C26H22BrN3O5 and a molecular weight of 536.38 g/mol. Its IUPAC name is ethyl 2-[2-bromo-6-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-6-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126410101 |
| Molecular Formula | C26H22BrN3O5 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | ethyl 2-[2-bromo-6-methoxy-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C26H22BrN3O5/c1-3-34-23(31)16-35-24-20(27)13-17(14-22(24)33-2)15-28-30-25(18-9-5-4-6-10-18)29-21-12-8-7-11-19(21)26(30)32/h4-15H,3,16H2,1-2H3 |
| InChIKey | UZXBCMXNTLTNOV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|