C24H20IN3O3 — CID 126408624
3-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126408624) has the molecular formula C24H20IN3O3 and a molecular weight of 525.35 g/mol. Its IUPAC name is 3-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126408624 |
| Molecular Formula | C24H20IN3O3 |
| Molecular Weight | 525.35 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 3-[(4-ethoxy-3-iodo-5-methoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | CCOc1c(I)cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc1OC |
| InChI | InChI=1S/C24H20IN3O3/c1-3-31-22-19(25)13-16(14-21(22)30-2)15-26-28-23(17-9-5-4-6-10-17)27-20-12-8-7-11-18(20)24(28)29/h4-15H,3H2,1-2H3 |
| InChIKey | OIEIVJSDSOLIMB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|