C25H19IN4O3 — CID 126409476
2-[2-ethoxy-6-iodo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile (PubChem CID 126409476) has the molecular formula C25H19IN4O3 and a molecular weight of 550.36 g/mol. Its IUPAC name is 2-[2-ethoxy-6-iodo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-ethoxy-6-iodo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 126409476 |
| Molecular Formula | C25H19IN4O3 |
| Molecular Weight | 550.36 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 2-[2-ethoxy-6-iodo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]acetonitrile |
| SMILES | CCOc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(I)c1OCC#N |
| InChI | InChI=1S/C25H19IN4O3/c1-2-32-22-15-17(14-20(26)23(22)33-13-12-27)16-28-30-24(18-8-4-3-5-9-18)29-21-11-7-6-10-19(21)25(30)31/h3-11,14-16H,2,13H2,1H3 |
| InChIKey | SHXTZVHACUNBBI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|