C30H22Cl2IN3O3 — CID 126405625
3-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126405625) has the molecular formula C30H22Cl2IN3O3 and a molecular weight of 670.33 g/mol. Its IUPAC name is 3-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126405625 |
| Molecular Formula | C30H22Cl2IN3O3 |
| Molecular Weight | 670.33 g/mol |
| Exact Mass | 669.01 |
| IUPAC Name | 3-[[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(I)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H22Cl2IN3O3/c1-2-38-27-16-20(15-25(33)28(27)39-18-19-12-13-23(31)24(32)14-19)17-34-36-29(21-8-4-3-5-9-21)35-26-11-7-6-10-22(26)30(36)37/h3-17H,2,18H2,1H3 |
| InChIKey | CCBGVXYOPWFHCG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.33 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|