C32H21Cl2N3O2 — CID 126410697
3-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126410697) has the molecular formula C32H21Cl2N3O2 and a molecular weight of 550.45 g/mol. Its IUPAC name is 3-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126410697 |
| Molecular Formula | C32H21Cl2N3O2 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 3-[[2-[(3,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1N=Cc1c(OCc2ccc(Cl)c(Cl)c2)ccc2ccccc12 |
| InChI | InChI=1S/C32H21Cl2N3O2/c33-27-16-14-21(18-28(27)34)20-39-30-17-15-22-8-4-5-11-24(22)26(30)19-35-37-31(23-9-2-1-3-10-23)36-29-13-7-6-12-25(29)32(37)38/h1-19H,20H2 |
| InChIKey | XAGAMQOOYIZDPR-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|