C33H22F3N3O2 — CID 126314574
3-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126314574) has the molecular formula C33H22F3N3O2 and a molecular weight of 549.55 g/mol. Its IUPAC name is 3-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126314574 |
| Molecular Formula | C33H22F3N3O2 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 3-[(2-phenylmethoxynaphthalen-1-yl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cccc(C(F)(F)F)c2)n1N=Cc1c(OCc2ccccc2)ccc2ccccc12 |
| InChI | InChI=1S/C33H22F3N3O2/c34-33(35,36)25-13-8-12-24(19-25)31-38-29-16-7-6-15-27(29)32(40)39(31)37-20-28-26-14-5-4-11-23(26)17-18-30(28)41-21-22-9-2-1-3-10-22/h1-20H,21H2 |
| InChIKey | XMKGDCWMAINGFP-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|