C30H23Cl2N3O3 — CID 126406150
3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126406150) has the molecular formula C30H23Cl2N3O3 and a molecular weight of 544.44 g/mol. Its IUPAC name is 3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126406150 |
| Molecular Formula | C30H23Cl2N3O3 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 3-[[3-chloro-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H23Cl2N3O3/c1-2-37-27-17-21(16-25(32)28(27)38-19-20-12-14-23(31)15-13-20)18-33-35-29(22-8-4-3-5-9-22)34-26-11-7-6-10-24(26)30(35)36/h3-18H,2,19H2,1H3 |
| InChIKey | DOVXDIJMIJSZKN-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|