C25H22BrN3O3 — CID 126406683
3-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126406683) has the molecular formula C25H22BrN3O3 and a molecular weight of 492.37 g/mol. Its IUPAC name is 3-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126406683 |
| Molecular Formula | C25H22BrN3O3 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 3-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(Br)c1OCC |
| InChI | InChI=1S/C25H22BrN3O3/c1-3-31-22-15-17(14-20(26)23(22)32-4-2)16-27-29-24(18-10-6-5-7-11-18)28-21-13-9-8-12-19(21)25(29)30/h5-16H,3-4H2,1-2H3 |
| InChIKey | GTSWBOYJMVHUGH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|