C25H19BrF3N3O3 — CID 126287916
3-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126287916) has the molecular formula C25H19BrF3N3O3 and a molecular weight of 546.34 g/mol. Its IUPAC name is 3-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126287916 |
| Molecular Formula | C25H19BrF3N3O3 |
| Molecular Weight | 546.34 g/mol |
| Exact Mass | 545.06 |
| IUPAC Name | 3-[(3-bromo-5-ethoxy-4-methoxyphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc(Br)c1OC |
| InChI | InChI=1S/C25H19BrF3N3O3/c1-3-35-21-12-15(11-19(26)22(21)34-2)14-30-32-23(16-7-6-8-17(13-16)25(27,28)29)31-20-10-5-4-9-18(20)24(32)33/h4-14H,3H2,1-2H3 |
| InChIKey | LSAGVVPKOXDBFQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.34 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|