C30H22BrN3O5 — CID 126408857
3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126408857) has the molecular formula C30H22BrN3O5 and a molecular weight of 584.43 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126408857 |
| Molecular Formula | C30H22BrN3O5 |
| Molecular Weight | 584.43 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-bromo-5-methoxyphenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc(Br)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H22BrN3O5/c1-36-27-15-20(13-23(31)28(27)37-17-19-11-12-25-26(14-19)39-18-38-25)16-32-34-29(21-7-3-2-4-8-21)33-24-10-6-5-9-22(24)30(34)35/h2-16H,17-18H2,1H3 |
| InChIKey | PPEVWLAWIGNMHA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|