C28H17BrCl3N3O2 — CID 126406084
3-[[3-bromo-5-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126406084) has the molecular formula C28H17BrCl3N3O2 and a molecular weight of 613.73 g/mol. Its IUPAC name is 3-[[3-bromo-5-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[3-bromo-5-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126406084 |
| Molecular Formula | C28H17BrCl3N3O2 |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 610.96 |
| IUPAC Name | 3-[[3-bromo-5-chloro-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1N=Cc1cc(Cl)c(OCc2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C28H17BrCl3N3O2/c29-22-12-17(13-24(32)26(22)37-16-19-10-11-20(30)14-23(19)31)15-33-35-27(18-6-2-1-3-7-18)34-25-9-5-4-8-21(25)28(35)36/h1-15H,16H2 |
| InChIKey | DGEGCHBMNHDUKA-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|