C28H18Br2N4O4 — CID 126410222
3-[[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one (PubChem CID 126410222) has the molecular formula C28H18Br2N4O4 and a molecular weight of 634.28 g/mol. Its IUPAC name is 3-[[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one.
| Compound Name | 3-[[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 126410222 |
| Molecular Formula | C28H18Br2N4O4 |
| Molecular Weight | 634.28 g/mol |
| Exact Mass | 631.97 |
| IUPAC Name | 3-[[3,5-dibromo-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-phenylquinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccccc2)n1N=Cc1cc(Br)c(OCc2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C28H18Br2N4O4/c29-23-14-19(15-24(30)26(23)38-17-18-10-12-21(13-11-18)34(36)37)16-31-33-27(20-6-2-1-3-7-20)32-25-9-5-4-8-22(25)28(33)35/h1-16H,17H2 |
| InChIKey | VMTHIGULHLZULR-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.28 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|