C30H18BrF3N4O6 — CID 126301571
4-[[2-bromo-6-nitro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126301571) has the molecular formula C30H18BrF3N4O6 and a molecular weight of 667.39 g/mol. Its IUPAC name is 4-[[2-bromo-6-nitro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-6-nitro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126301571 |
| Molecular Formula | C30H18BrF3N4O6 |
| Molecular Weight | 667.39 g/mol |
| Exact Mass | 666.04 |
| IUPAC Name | 4-[[2-bromo-6-nitro-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2c(Br)cc(C=Nn3c(-c4cccc(C(F)(F)F)c4)nc4ccccc4c3=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H18BrF3N4O6/c31-23-12-18(13-25(38(42)43)26(23)44-16-17-8-10-19(11-9-17)29(40)41)15-35-37-27(20-4-3-5-21(14-20)30(32,33)34)36-24-7-2-1-6-22(24)28(37)39/h1-15H,16H2,(H,40,41) |
| InChIKey | DMXFSYWCUKRDEU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.39 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|