C29H16BrCl2F3N4O4 — CID 126293459
3-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126293459) has the molecular formula C29H16BrCl2F3N4O4 and a molecular weight of 692.28 g/mol. Its IUPAC name is 3-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126293459 |
| Molecular Formula | C29H16BrCl2F3N4O4 |
| Molecular Weight | 692.28 g/mol |
| Exact Mass | 689.97 |
| IUPAC Name | 3-[[5-bromo-2-[(3,4-dichlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cccc(C(F)(F)F)c2)n1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H16BrCl2F3N4O4/c30-20-12-18(26(25(13-20)39(41)42)43-15-16-8-9-22(31)23(32)10-16)14-36-38-27(17-4-3-5-19(11-17)29(33,34)35)37-24-7-2-1-6-21(24)28(38)40/h1-14H,15H2 |
| InChIKey | SZSFPKXMXLUSQC-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.28 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|