C30H18Br2F3N3O4 — CID 126295947
4-[[2,6-dibromo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126295947) has the molecular formula C30H18Br2F3N3O4 and a molecular weight of 701.29 g/mol. Its IUPAC name is 4-[[2,6-dibromo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dibromo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126295947 |
| Molecular Formula | C30H18Br2F3N3O4 |
| Molecular Weight | 701.29 g/mol |
| Exact Mass | 698.96 |
| IUPAC Name | 4-[[2,6-dibromo-4-[[4-oxo-2-[3-(trifluoromethyl)phenyl]quinazolin-3-yl]iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2c(Br)cc(C=Nn3c(-c4cccc(C(F)(F)F)c4)nc4ccccc4c3=O)cc2Br)cc1 |
| InChI | InChI=1S/C30H18Br2F3N3O4/c31-23-12-18(13-24(32)26(23)42-16-17-8-10-19(11-9-17)29(40)41)15-36-38-27(20-4-3-5-21(14-20)30(33,34)35)37-25-7-2-1-6-22(25)28(38)39/h1-15H,16H2,(H,40,41) |
| InChIKey | PBAPCIMXBQTELP-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.29 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|