C30H20F3N5O7 — CID 126311244
3-[[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one (PubChem CID 126311244) has the molecular formula C30H20F3N5O7 and a molecular weight of 619.51 g/mol. Its IUPAC name is 3-[[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one.
| Compound Name | 3-[[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
|---|---|
| PubChem CID | 126311244 |
| Molecular Formula | C30H20F3N5O7 |
| Molecular Weight | 619.51 g/mol |
| Exact Mass | 619.13 |
| IUPAC Name | 3-[[3-methoxy-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-[3-(trifluoromethyl)phenyl]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(-c3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H20F3N5O7/c1-44-26-14-19(13-25(38(42)43)27(26)45-17-18-9-11-22(12-10-18)37(40)41)16-34-36-28(20-5-4-6-21(15-20)30(31,32)33)35-24-8-3-2-7-23(24)29(36)39/h2-16H,17H2,1H3 |
| InChIKey | LUBVFTVUYIWWJZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 151.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|