C29H18Br2N4O2 — CID 126407589
2-[[2,6-dibromo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzonitrile (PubChem CID 126407589) has the molecular formula C29H18Br2N4O2 and a molecular weight of 614.30 g/mol. Its IUPAC name is 2-[[2,6-dibromo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dibromo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126407589 |
| Molecular Formula | C29H18Br2N4O2 |
| Molecular Weight | 614.30 g/mol |
| Exact Mass | 611.98 |
| IUPAC Name | 2-[[2,6-dibromo-4-[(4-oxo-2-phenylquinazolin-3-yl)iminomethyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Br)cc(C=Nn2c(-c3ccccc3)nc3ccccc3c2=O)cc1Br |
| InChI | InChI=1S/C29H18Br2N4O2/c30-24-14-19(15-25(31)27(24)37-18-22-11-5-4-10-21(22)16-32)17-33-35-28(20-8-2-1-3-9-20)34-26-13-7-6-12-23(26)29(35)36/h1-15,17H,18H2 |
| InChIKey | KQVUCEHJKXIIAU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.30 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|