C31H18Br2N4O3 — CID 126292336
2-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dibromophenoxy]methyl]benzonitrile (PubChem CID 126292336) has the molecular formula C31H18Br2N4O3 and a molecular weight of 654.32 g/mol. Its IUPAC name is 2-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dibromophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dibromophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126292336 |
| Molecular Formula | C31H18Br2N4O3 |
| Molecular Weight | 654.32 g/mol |
| Exact Mass | 651.97 |
| IUPAC Name | 2-[[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dibromophenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Br)cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1Br |
| InChI | InChI=1S/C31H18Br2N4O3/c32-24-13-19(14-25(33)29(24)39-18-22-9-2-1-8-21(22)16-34)17-35-37-30(28-15-20-7-3-6-12-27(20)40-28)36-26-11-5-4-10-23(26)31(37)38/h1-15,17H,18H2 |
| InChIKey | VYIHFAMNGJPNDN-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.32 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|