C25H14BrClN4O3 — CID 126291958
2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-bromo-6-chlorophenoxy]acetonitrile (PubChem CID 126291958) has the molecular formula C25H14BrClN4O3 and a molecular weight of 533.77 g/mol. Its IUPAC name is 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-bromo-6-chlorophenoxy]acetonitrile.
| Compound Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-bromo-6-chlorophenoxy]acetonitrile |
|---|---|
| PubChem CID | 126291958 |
| Molecular Formula | C25H14BrClN4O3 |
| Molecular Weight | 533.77 g/mol |
| Exact Mass | 531.99 |
| IUPAC Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-bromo-6-chlorophenoxy]acetonitrile |
| SMILES | N#CCOc1c(Cl)cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1Br |
| InChI | InChI=1S/C25H14BrClN4O3/c26-18-11-15(12-19(27)23(18)33-10-9-28)14-29-31-24(22-13-16-5-1-4-8-21(16)34-22)30-20-7-3-2-6-17(20)25(31)32/h1-8,11-14H,10H2 |
| InChIKey | OMTNKOSYOMLPAA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.77 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|