C25H15ClN4O3 — CID 126298406
2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chlorophenoxy]acetonitrile (PubChem CID 126298406) has the molecular formula C25H15ClN4O3 and a molecular weight of 454.87 g/mol. Its IUPAC name is 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chlorophenoxy]acetonitrile.
| Compound Name | 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chlorophenoxy]acetonitrile |
|---|---|
| PubChem CID | 126298406 |
| Molecular Formula | C25H15ClN4O3 |
| Molecular Weight | 454.87 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chlorophenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(Cl)cc1C=Nn1c(-c2cc3ccccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H15ClN4O3/c26-18-9-10-21(32-12-11-27)17(13-18)15-28-30-24(23-14-16-5-1-4-8-22(16)33-23)29-20-7-3-2-6-19(20)25(30)31/h1-10,13-15H,12H2 |
| InChIKey | SQFFFKBIUGBHJD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|