C26H18ClN3O5 — CID 126304083
(2R)-2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chlorophenoxy]propanoic acid (PubChem CID 126304083) has the molecular formula C26H18ClN3O5 and a molecular weight of 487.90 g/mol. Its IUPAC name is (2R)-2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chlorophenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chlorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 126304083 |
| Molecular Formula | C26H18ClN3O5 |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (2R)-2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-4-chlorophenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1C=Nn1c(-c2cc3ccccc3o2)nc2ccccc2c1=O)C(=O)O |
| InChI | InChI=1S/C26H18ClN3O5/c1-15(26(32)33)34-22-11-10-18(27)12-17(22)14-28-30-24(23-13-16-6-2-5-9-21(16)35-23)29-20-8-4-3-7-19(20)25(30)31/h2-15H,1H3,(H,32,33)/t15-/m1/s1 |
| InChIKey | LPKWWZFNXLKZKK-OAHLLOKOSA-N |
| XLogP | 5.20 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|