C26H19N3O5 — CID 126306631
(2S)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]propanoic acid (PubChem CID 126306631) has the molecular formula C26H19N3O5 and a molecular weight of 453.45 g/mol. Its IUPAC name is (2S)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126306631 |
| Molecular Formula | C26H19N3O5 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (2S)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]propanoic acid |
| SMILES | C[C@H](Oc1ccc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1)C(=O)O |
| InChI | InChI=1S/C26H19N3O5/c1-16(26(31)32)33-19-12-10-17(11-13-19)15-27-29-24(23-14-18-6-2-5-9-22(18)34-23)28-21-8-4-3-7-20(21)25(29)30/h2-16H,1H3,(H,31,32)/t16-/m0/s1 |
| InChIKey | WWZWBPSWHXSFKW-INIZCTEOSA-N |
| XLogP | 4.54 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|