C26H18N4O7 — CID 126298689
(2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]propanoic acid (PubChem CID 126298689) has the molecular formula C26H18N4O7 and a molecular weight of 498.45 g/mol. Its IUPAC name is (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]propanoic acid |
|---|---|
| PubChem CID | 126298689 |
| Molecular Formula | C26H18N4O7 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | (2R)-2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-nitrophenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1ccc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C26H18N4O7/c1-15(26(32)33)36-22-11-10-16(12-20(22)30(34)35)14-27-29-24(23-13-17-6-2-5-9-21(17)37-23)28-19-8-4-3-7-18(19)25(29)31/h2-15H,1H3,(H,32,33)/t15-/m1/s1 |
| InChIKey | UPLFKKLIEWXBFF-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|