C23H13ClN4O4 — CID 126299293
2-(1-benzofuran-2-yl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]quinazolin-4-one (PubChem CID 126299293) has the molecular formula C23H13ClN4O4 and a molecular weight of 444.83 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126299293 |
| Molecular Formula | C23H13ClN4O4 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[(4-chloro-3-nitrophenyl)methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3ccccc3o2)n1N=Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H13ClN4O4/c24-17-10-9-14(11-19(17)28(30)31)13-25-27-22(21-12-15-5-1-4-8-20(15)32-21)26-18-7-3-2-6-16(18)23(27)29/h1-13H |
| InChIKey | JFHBGUFVAOTQEA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 103.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|