C26H19N5O7 — CID 126294245
2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetamide (PubChem CID 126294245) has the molecular formula C26H19N5O7 and a molecular weight of 513.47 g/mol. Its IUPAC name is 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetamide.
| Compound Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetamide |
|---|---|
| PubChem CID | 126294245 |
| Molecular Formula | C26H19N5O7 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 2-[4-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetamide |
| SMILES | COc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCC(N)=O |
| InChI | InChI=1S/C26H19N5O7/c1-36-21-11-15(10-19(31(34)35)24(21)37-14-23(27)32)13-28-30-25(22-12-16-6-2-5-9-20(16)38-22)29-18-8-4-3-7-17(18)26(30)33/h2-13H,14H2,1H3,(H2,27,32) |
| InChIKey | CNXIWOBHIYOZBB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 165.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|