C28H21ClN4O8 — CID 126285917
ethyl 2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetate (PubChem CID 126285917) has the molecular formula C28H21ClN4O8 and a molecular weight of 576.95 g/mol. Its IUPAC name is ethyl 2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetate.
| Compound Name | ethyl 2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 126285917 |
| Molecular Formula | C28H21ClN4O8 |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | ethyl 2-[4-[[2-(5-chloro-1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(OC)cc(C=Nn2c(-c3cc4cc(Cl)ccc4o3)nc3ccccc3c2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H21ClN4O8/c1-3-39-25(34)15-40-26-21(33(36)37)10-16(11-23(26)38-2)14-30-32-27(31-20-7-5-4-6-19(20)28(32)35)24-13-17-12-18(29)8-9-22(17)41-24/h4-14H,3,15H2,1-2H3 |
| InChIKey | IIFPZLUAONCTQL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 148.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|