C25H18N4O6 — CID 137068200
2-(1-benzofuran-2-yl)-3-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]quinazolin-4-one (PubChem CID 137068200) has the molecular formula C25H18N4O6 and a molecular weight of 470.44 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 137068200 |
| Molecular Formula | C25H18N4O6 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc4ccccc4o3)nc3ccccc3c2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C25H18N4O6/c1-2-34-21-12-15(11-19(23(21)30)29(32)33)14-26-28-24(22-13-16-7-3-6-10-20(16)35-22)27-18-9-5-4-8-17(18)25(28)31/h3-14,30H,2H2,1H3 |
| InChIKey | XBNQMFVAJISSIH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|