C29H30N4O6 — CID 137036391
3-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 137036391) has the molecular formula C29H30N4O6 and a molecular weight of 530.58 g/mol. Its IUPAC name is 3-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 137036391 |
| Molecular Formula | C29H30N4O6 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 3-[(3-ethoxy-4-hydroxy-5-nitrophenyl)methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(OCC)c(O)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C29H30N4O6/c1-6-38-25-12-18(5)22(15-21(25)17(3)4)28-31-23-11-9-8-10-20(23)29(35)32(28)30-16-19-13-24(33(36)37)27(34)26(14-19)39-7-2/h8-17,34H,6-7H2,1-5H3 |
| InChIKey | XMELRXFOJSDGIK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|