C36H36N4O6 — CID 126305879
3-[[3-ethoxy-4-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126305879) has the molecular formula C36H36N4O6 and a molecular weight of 620.71 g/mol. Its IUPAC name is 3-[[3-ethoxy-4-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-ethoxy-4-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126305879 |
| Molecular Formula | C36H36N4O6 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 3-[[3-ethoxy-4-[(3-methylphenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc(C(C)C)c(OC)cc3C)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C36H36N4O6/c1-7-45-33-18-26(17-31(40(42)43)34(33)46-21-25-12-10-11-23(4)15-25)20-37-39-35(38-30-14-9-8-13-27(30)36(39)41)29-19-28(22(2)3)32(44-6)16-24(29)5/h8-20,22H,7,21H2,1-6H3 |
| InChIKey | UTUZFCIPDPMUEJ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|