C35H33BrN4O6 — CID 126293353
3-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126293353) has the molecular formula C35H33BrN4O6 and a molecular weight of 685.58 g/mol. Its IUPAC name is 3-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126293353 |
| Molecular Formula | C35H33BrN4O6 |
| Molecular Weight | 685.58 g/mol |
| Exact Mass | 684.16 |
| IUPAC Name | 3-[[3-bromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Br)c(OCc3cccc([N+](=O)[O-])c3)c(OC)c2)cc1C(C)C |
| InChI | InChI=1S/C35H33BrN4O6/c1-6-45-31-14-22(4)28(18-27(31)21(2)3)34-38-30-13-8-7-12-26(30)35(41)39(34)37-19-24-16-29(36)33(32(17-24)44-5)46-20-23-10-9-11-25(15-23)40(42)43/h7-19,21H,6,20H2,1-5H3 |
| InChIKey | SRSNULYZOGOKKI-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.58 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|