C36H35ClN4O6 — CID 126298806
3-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126298806) has the molecular formula C36H35ClN4O6 and a molecular weight of 655.15 g/mol. Its IUPAC name is 3-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126298806 |
| Molecular Formula | C36H35ClN4O6 |
| Molecular Weight | 655.15 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | 3-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Cl)c(OCc3cccc([N+](=O)[O-])c3)c(OCC)c2)cc1C(C)C |
| InChI | InChI=1S/C36H35ClN4O6/c1-6-45-32-15-23(5)29(19-28(32)22(3)4)35-39-31-14-9-8-13-27(31)36(42)40(35)38-20-25-17-30(37)34(33(18-25)46-7-2)47-21-24-11-10-12-26(16-24)41(43)44/h8-20,22H,6-7,21H2,1-5H3 |
| InChIKey | HUOKIIZWDNKASI-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.15 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|