C35H34N4O7 — CID 126282623
3-[[3,5-dimethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126282623) has the molecular formula C35H34N4O7 and a molecular weight of 622.68 g/mol. Its IUPAC name is 3-[[3,5-dimethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3,5-dimethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126282623 |
| Molecular Formula | C35H34N4O7 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 3-[[3,5-dimethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(OC)c(OCc3cccc([N+](=O)[O-])c3)c(OC)c2)cc1C(C)C |
| InChI | InChI=1S/C35H34N4O7/c1-21(2)27-18-28(22(3)14-30(27)43-4)34-37-29-13-8-7-12-26(29)35(40)38(34)36-19-24-16-31(44-5)33(32(17-24)45-6)46-20-23-10-9-11-25(15-23)39(41)42/h7-19,21H,20H2,1-6H3 |
| InChIKey | RMEFJFMOYUJQOH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 127.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|