C34H31IN4O6 — CID 126304101
3-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126304101) has the molecular formula C34H31IN4O6 and a molecular weight of 718.55 g/mol. Its IUPAC name is 3-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126304101 |
| Molecular Formula | C34H31IN4O6 |
| Molecular Weight | 718.55 g/mol |
| Exact Mass | 718.13 |
| IUPAC Name | 3-[[3-iodo-5-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | COc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(I)c(OCc3ccc([N+](=O)[O-])cc3)c(OC)c2)cc1C(C)C |
| InChI | InChI=1S/C34H31IN4O6/c1-20(2)26-17-27(21(3)14-30(26)43-4)33-37-29-9-7-6-8-25(29)34(40)38(33)36-18-23-15-28(35)32(31(16-23)44-5)45-19-22-10-12-24(13-11-22)39(41)42/h6-18,20H,19H2,1-5H3 |
| InChIKey | UXUPLGLZBSLCKV-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.55 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|