C35H33N5O8 — CID 126311125
3-[[3-ethoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126311125) has the molecular formula C35H33N5O8 and a molecular weight of 651.68 g/mol. Its IUPAC name is 3-[[3-ethoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-ethoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126311125 |
| Molecular Formula | C35H33N5O8 |
| Molecular Weight | 651.68 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | 3-[[3-ethoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(-c3cc(C(C)C)c(OC)cc3C)nc3ccccc3c2=O)cc([N+](=O)[O-])c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C35H33N5O8/c1-6-47-32-17-24(16-30(40(44)45)33(32)48-20-23-10-9-11-25(15-23)39(42)43)19-36-38-34(37-29-13-8-7-12-26(29)35(38)41)28-18-27(21(2)3)31(46-5)14-22(28)4/h7-19,21H,6,20H2,1-5H3 |
| InChIKey | LICBHCYGKQMXLD-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 161.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.68 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|