C35H32Cl2N4O6 — CID 126296454
3-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126296454) has the molecular formula C35H32Cl2N4O6 and a molecular weight of 675.57 g/mol. Its IUPAC name is 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126296454 |
| Molecular Formula | C35H32Cl2N4O6 |
| Molecular Weight | 675.57 g/mol |
| Exact Mass | 674.17 |
| IUPAC Name | 3-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(OC)c(OCc3ccc(Cl)cc3Cl)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C35H32Cl2N4O6/c1-6-46-31-13-21(4)27(17-26(31)20(2)3)34-39-29-10-8-7-9-25(29)35(42)40(34)38-18-22-14-30(41(43)44)33(32(15-22)45-5)47-19-23-11-12-24(36)16-28(23)37/h7-18,20H,6,19H2,1-5H3 |
| InChIKey | KXORGPCKWBMUDT-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.57 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|