C34H30ClFN4O5 — CID 126309848
3-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126309848) has the molecular formula C34H30ClFN4O5 and a molecular weight of 629.09 g/mol. Its IUPAC name is 3-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126309848 |
| Molecular Formula | C34H30ClFN4O5 |
| Molecular Weight | 629.09 g/mol |
| Exact Mass | 628.19 |
| IUPAC Name | 3-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Cl)c(OCc3ccccc3F)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C34H30ClFN4O5/c1-5-44-31-14-21(4)26(17-25(31)20(2)3)33-38-29-13-9-7-11-24(29)34(41)39(33)37-18-22-15-27(35)32(30(16-22)40(42)43)45-19-23-10-6-8-12-28(23)36/h6-18,20H,5,19H2,1-4H3 |
| InChIKey | JFSZPMFJHPTNPD-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.09 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|