C35H32ClN5O6 — CID 126292142
2-[2-chloro-4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-phenylacetamide (PubChem CID 126292142) has the molecular formula C35H32ClN5O6 and a molecular weight of 654.12 g/mol. Its IUPAC name is 2-[2-chloro-4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-chloro-4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126292142 |
| Molecular Formula | C35H32ClN5O6 |
| Molecular Weight | 654.12 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | 2-[2-chloro-4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-phenylacetamide |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Cl)c(OCC(=O)Nc3ccccc3)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C35H32ClN5O6/c1-5-46-31-15-22(4)27(18-26(31)21(2)3)34-39-29-14-10-9-13-25(29)35(43)40(34)37-19-23-16-28(36)33(30(17-23)41(44)45)47-20-32(42)38-24-11-7-6-8-12-24/h6-19,21H,5,20H2,1-4H3,(H,38,42) |
| InChIKey | PHXNONXMSOSMMN-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.12 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|