C31H32N4O8 — CID 126312165
(2R)-2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]propanoic acid (PubChem CID 126312165) has the molecular formula C31H32N4O8 and a molecular weight of 588.62 g/mol. Its IUPAC name is (2R)-2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]propanoic acid |
|---|---|
| PubChem CID | 126312165 |
| Molecular Formula | C31H32N4O8 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | (2R)-2-[4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]propanoic acid |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(OC)c(O[C@H](C)C(=O)O)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C31H32N4O8/c1-7-42-26-12-18(4)23(15-22(26)17(2)3)29-33-24-11-9-8-10-21(24)30(36)34(29)32-16-20-13-25(35(39)40)28(27(14-20)41-6)43-19(5)31(37)38/h8-17,19H,7H2,1-6H3,(H,37,38)/t19-/m1/s1 |
| InChIKey | OSDSRHSPPMYCRM-LJQANCHMSA-N |
| XLogP | 5.54 |
| TPSA | 155.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|