C33H38N4O6 — CID 126284521
3-[[4-(2,2-dimethylpropoxy)-3-methoxy-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 126284521) has the molecular formula C33H38N4O6 and a molecular weight of 586.69 g/mol. Its IUPAC name is 3-[[4-(2,2-dimethylpropoxy)-3-methoxy-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 3-[[4-(2,2-dimethylpropoxy)-3-methoxy-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 126284521 |
| Molecular Formula | C33H38N4O6 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 3-[[4-(2,2-dimethylpropoxy)-3-methoxy-5-nitrophenyl]methylideneamino]-2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(OC)c(OCC(C)(C)C)c([N+](=O)[O-])c2)cc1C(C)C |
| InChI | InChI=1S/C33H38N4O6/c1-9-42-28-14-21(4)25(17-24(28)20(2)3)31-35-26-13-11-10-12-23(26)32(38)36(31)34-18-22-15-27(37(39)40)30(29(16-22)41-8)43-19-33(5,6)7/h10-18,20H,9,19H2,1-8H3 |
| InChIKey | DPLJFQNJNRLNQP-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|