C35H31Cl2N5O6 — CID 126284016
2-[4-chloro-2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126284016) has the molecular formula C35H31Cl2N5O6 and a molecular weight of 688.57 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-chloro-2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126284016 |
| Molecular Formula | C35H31Cl2N5O6 |
| Molecular Weight | 688.57 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | 2-[4-chloro-2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(Cl)cc([N+](=O)[O-])c2OCC(=O)Nc2ccc(Cl)cc2)cc1C(C)C |
| InChI | InChI=1S/C35H31Cl2N5O6/c1-5-47-31-14-21(4)28(17-27(31)20(2)3)34-40-29-9-7-6-8-26(29)35(44)41(34)38-18-22-15-24(37)16-30(42(45)46)33(22)48-19-32(43)39-25-12-10-23(36)11-13-25/h6-18,20H,5,19H2,1-4H3,(H,39,43) |
| InChIKey | BHYLXGRIRXKWJT-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.57 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|