C29H29N5O6 — CID 126302597
2-[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]acetamide (PubChem CID 126302597) has the molecular formula C29H29N5O6 and a molecular weight of 543.58 g/mol. Its IUPAC name is 2-[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]acetamide.
| Compound Name | 2-[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]acetamide |
|---|---|
| PubChem CID | 126302597 |
| Molecular Formula | C29H29N5O6 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 2-[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]acetamide |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cccc([N+](=O)[O-])c2OCC(N)=O)cc1C(C)C |
| InChI | InChI=1S/C29H29N5O6/c1-5-39-25-13-18(4)22(14-21(25)17(2)3)28-32-23-11-7-6-10-20(23)29(36)33(28)31-15-19-9-8-12-24(34(37)38)27(19)40-16-26(30)35/h6-15,17H,5,16H2,1-4H3,(H2,30,35) |
| InChIKey | IEEIPUQKSRJYET-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|