C29H28N4O6 — CID 126292959
[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenyl] acetate (PubChem CID 126292959) has the molecular formula C29H28N4O6 and a molecular weight of 528.57 g/mol. Its IUPAC name is [2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenyl] acetate.
| Compound Name | [2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenyl] acetate |
|---|---|
| PubChem CID | 126292959 |
| Molecular Formula | C29H28N4O6 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | [2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenyl] acetate |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cccc([N+](=O)[O-])c2OC(C)=O)cc1C(C)C |
| InChI | InChI=1S/C29H28N4O6/c1-6-38-26-14-18(4)23(15-22(26)17(2)3)28-31-24-12-8-7-11-21(24)29(35)32(28)30-16-20-10-9-13-25(33(36)37)27(20)39-19(5)34/h7-17H,6H2,1-5H3 |
| InChIKey | ZUAKVACZBHDRQR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|