C32H34N4O7 — CID 126313828
ethyl (2S)-2-[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]propanoate (PubChem CID 126313828) has the molecular formula C32H34N4O7 and a molecular weight of 586.65 g/mol. Its IUPAC name is ethyl (2S)-2-[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]propanoate.
| Compound Name | ethyl (2S)-2-[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]propanoate |
|---|---|
| PubChem CID | 126313828 |
| Molecular Formula | C32H34N4O7 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | ethyl (2S)-2-[2-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]propanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1c(C=Nn2c(-c3cc(C(C)C)c(OCC)cc3C)nc3ccccc3c2=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H34N4O7/c1-7-41-28-16-20(5)25(17-24(28)19(3)4)30-34-26-14-10-9-13-23(26)31(37)35(30)33-18-22-12-11-15-27(36(39)40)29(22)43-21(6)32(38)42-8-2/h9-19,21H,7-8H2,1-6H3/t21-/m0/s1 |
| InChIKey | UGHRHPVGETTWGN-NRFANRHFSA-N |
| XLogP | 6.01 |
| TPSA | 135.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|