C37H43N3O6 — CID 126312522
ethyl (2R)-2-[2-ethoxy-4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-prop-2-enylphenoxy]propanoate (PubChem CID 126312522) has the molecular formula C37H43N3O6 and a molecular weight of 625.77 g/mol. Its IUPAC name is ethyl (2R)-2-[2-ethoxy-4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-prop-2-enylphenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[2-ethoxy-4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-prop-2-enylphenoxy]propanoate |
|---|---|
| PubChem CID | 126312522 |
| Molecular Formula | C37H43N3O6 |
| Molecular Weight | 625.77 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | ethyl (2R)-2-[2-ethoxy-4-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-6-prop-2-enylphenoxy]propanoate |
| SMILES | C=CCc1cc(C=Nn2c(-c3cc(C(C)C)c(OCC)cc3C)nc3ccccc3c2=O)cc(OCC)c1O[C@H](C)C(=O)OCC |
| InChI | InChI=1S/C37H43N3O6/c1-9-15-27-19-26(20-33(44-11-3)34(27)46-25(8)37(42)45-12-4)22-38-40-35(39-31-17-14-13-16-28(31)36(40)41)30-21-29(23(5)6)32(43-10-2)18-24(30)7/h9,13-14,16-23,25H,1,10-12,15H2,2-8H3/t25-/m1/s1 |
| InChIKey | OZRUGWALFPANBS-RUZDIDTESA-N |
| XLogP | 7.23 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.77 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|